C17H25N5O2 — CID 112887682
2-N-(2,5-dimethoxyphenyl)-4-N-[3-(dimethylamino)propyl]pyrimidine-2,4-diamine (PubChem CID 112887682) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-N-(2,5-dimethoxyphenyl)-4-N-[3-(dimethylamino)propyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2,5-dimethoxyphenyl)-4-N-[3-(dimethylamino)propyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112887682 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 2-N-(2,5-dimethoxyphenyl)-4-N-[3-(dimethylamino)propyl]pyrimidine-2,4-diamine |
| SMILES | COc1ccc(OC)c(Nc2nccc(NCCCN(C)C)n2)c1 |
| InChI | InChI=1S/C17H25N5O2/c1-22(2)11-5-9-18-16-8-10-19-17(21-16)20-14-12-13(23-3)6-7-15(14)24-4/h6-8,10,12H,5,9,11H2,1-4H3,(H2,18,19,20,21) |
| InChIKey | BCVYYZNPGJJNBS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|