C17H22N4O2 — CID 112884245
4-N-cyclopentyl-2-N-(2,5-dimethoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 112884245) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 4-N-cyclopentyl-2-N-(2,5-dimethoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-cyclopentyl-2-N-(2,5-dimethoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112884245 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 4-N-cyclopentyl-2-N-(2,5-dimethoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1ccc(OC)c(Nc2nccc(NC3CCCC3)n2)c1 |
| InChI | InChI=1S/C17H22N4O2/c1-22-13-7-8-15(23-2)14(11-13)20-17-18-10-9-16(21-17)19-12-5-3-4-6-12/h7-12H,3-6H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | HJUPCEWHKKBEPR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |