C18H22ClF3N6O — CID 159714746
1-(3-chloro-4-methylphenyl)-3-[4-[3-(dimethylamino)propylamino]-6-(trifluoromethyl)pyrimidin-2-yl]urea (PubChem CID 159714746) has the molecular formula C18H22ClF3N6O and a molecular weight of 430.86 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[4-[3-(dimethylamino)propylamino]-6-(trifluoromethyl)pyrimidin-2-yl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[4-[3-(dimethylamino)propylamino]-6-(trifluoromethyl)pyrimidin-2-yl]urea |
|---|---|
| PubChem CID | 159714746 |
| Molecular Formula | C18H22ClF3N6O |
| Molecular Weight | 430.86 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[4-[3-(dimethylamino)propylamino]-6-(trifluoromethyl)pyrimidin-2-yl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2nc(NCCCN(C)C)cc(C(F)(F)F)n2)cc1Cl |
| InChI | InChI=1S/C18H22ClF3N6O/c1-11-5-6-12(9-13(11)19)24-17(29)27-16-25-14(18(20,21)22)10-15(26-16)23-7-4-8-28(2)3/h5-6,9-10H,4,7-8H2,1-3H3,(H3,23,24,25,26,27,29) |
| InChIKey | BYXFDYSLKVRANT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.86 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|