C19H25ClN6O — CID 160817652
1-(3-chloro-4-methylphenyl)-3-[4-cyclopropyl-6-[3-(methylamino)propylamino]pyrimidin-2-yl]urea (PubChem CID 160817652) has the molecular formula C19H25ClN6O and a molecular weight of 388.90 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[4-cyclopropyl-6-[3-(methylamino)propylamino]pyrimidin-2-yl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[4-cyclopropyl-6-[3-(methylamino)propylamino]pyrimidin-2-yl]urea |
|---|---|
| PubChem CID | 160817652 |
| Molecular Formula | C19H25ClN6O |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[4-cyclopropyl-6-[3-(methylamino)propylamino]pyrimidin-2-yl]urea |
| SMILES | CNCCCNc1cc(C2CC2)nc(NC(=O)Nc2ccc(C)c(Cl)c2)n1 |
| InChI | InChI=1S/C19H25ClN6O/c1-12-4-7-14(10-15(12)20)23-19(27)26-18-24-16(13-5-6-13)11-17(25-18)22-9-3-8-21-2/h4,7,10-11,13,21H,3,5-6,8-9H2,1-2H3,(H3,22,23,24,25,26,27) |
| InChIKey | UUBDXEDOQAYDQS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|