C15H16ClN5O2 — CID 158171276
1-(4-chloro-3-methylphenyl)-3-[4-cyclopropyl-6-(hydroxyamino)pyrimidin-2-yl]urea (PubChem CID 158171276) has the molecular formula C15H16ClN5O2 and a molecular weight of 333.78 g/mol. Its IUPAC name is 1-(4-chloro-3-methylphenyl)-3-[4-cyclopropyl-6-(hydroxyamino)pyrimidin-2-yl]urea.
| Compound Name | 1-(4-chloro-3-methylphenyl)-3-[4-cyclopropyl-6-(hydroxyamino)pyrimidin-2-yl]urea |
|---|---|
| PubChem CID | 158171276 |
| Molecular Formula | C15H16ClN5O2 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 1-(4-chloro-3-methylphenyl)-3-[4-cyclopropyl-6-(hydroxyamino)pyrimidin-2-yl]urea |
| SMILES | Cc1cc(NC(=O)Nc2nc(NO)cc(C3CC3)n2)ccc1Cl |
| InChI | InChI=1S/C15H16ClN5O2/c1-8-6-10(4-5-11(8)16)17-15(22)20-14-18-12(9-2-3-9)7-13(19-14)21-23/h4-7,9,23H,2-3H2,1H3,(H3,17,18,19,20,21,22) |
| InChIKey | DKBZWEBVAFGAJQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 99.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|