C17H20Cl2N6O — CID 122507220
1-(3,4-dichlorophenyl)-3-[4-methyl-6-(piperidin-3-ylamino)pyrimidin-2-yl]urea (PubChem CID 122507220) has the molecular formula C17H20Cl2N6O and a molecular weight of 395.29 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[4-methyl-6-(piperidin-3-ylamino)pyrimidin-2-yl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[4-methyl-6-(piperidin-3-ylamino)pyrimidin-2-yl]urea |
|---|---|
| PubChem CID | 122507220 |
| Molecular Formula | C17H20Cl2N6O |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[4-methyl-6-(piperidin-3-ylamino)pyrimidin-2-yl]urea |
| SMILES | Cc1cc(NC2CCCNC2)nc(NC(=O)Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C17H20Cl2N6O/c1-10-7-15(22-12-3-2-6-20-9-12)24-16(21-10)25-17(26)23-11-4-5-13(18)14(19)8-11/h4-5,7-8,12,20H,2-3,6,9H2,1H3,(H3,21,22,23,24,25,26) |
| InChIKey | HYMXJPDZSZEZLR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |