C17H18Cl3N3O — CID 67238951
1-(3,4-dichlorophenyl)-3-(4-pyrrolidin-3-ylphenyl)urea;hydrochloride (PubChem CID 67238951) has the molecular formula C17H18Cl3N3O and a molecular weight of 386.71 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(4-pyrrolidin-3-ylphenyl)urea;hydrochloride.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(4-pyrrolidin-3-ylphenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 67238951 |
| Molecular Formula | C17H18Cl3N3O |
| Molecular Weight | 386.71 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(4-pyrrolidin-3-ylphenyl)urea;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc(C2CCNC2)cc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2N3O.ClH/c18-15-6-5-14(9-16(15)19)22-17(23)21-13-3-1-11(2-4-13)12-7-8-20-10-12;/h1-6,9,12,20H,7-8,10H2,(H2,21,22,23);1H |
| InChIKey | GSMRYEYRTILKNX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.71 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |