C13H17Cl2N3O — CID 63622133
1-(3,4-dichlorophenyl)-3-(2-pyrrolidin-3-ylethyl)urea (PubChem CID 63622133) has the molecular formula C13H17Cl2N3O and a molecular weight of 302.20 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(2-pyrrolidin-3-ylethyl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(2-pyrrolidin-3-ylethyl)urea |
|---|---|
| PubChem CID | 63622133 |
| Molecular Formula | C13H17Cl2N3O |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(2-pyrrolidin-3-ylethyl)urea |
| SMILES | O=C(NCCC1CCNC1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2N3O/c14-11-2-1-10(7-12(11)15)18-13(19)17-6-4-9-3-5-16-8-9/h1-2,7,9,16H,3-6,8H2,(H2,17,18,19) |
| InChIKey | ACXIJZDZQCDABQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |