C18H26Cl2N2O — CID 119535702
2-(3,4-dichlorophenyl)-2-ethyl-N-(2-pyrrolidin-3-ylethyl)butanamide (PubChem CID 119535702) has the molecular formula C18H26Cl2N2O and a molecular weight of 357.33 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-2-ethyl-N-(2-pyrrolidin-3-ylethyl)butanamide.
| Compound Name | 2-(3,4-dichlorophenyl)-2-ethyl-N-(2-pyrrolidin-3-ylethyl)butanamide |
|---|---|
| PubChem CID | 119535702 |
| Molecular Formula | C18H26Cl2N2O |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-2-ethyl-N-(2-pyrrolidin-3-ylethyl)butanamide |
| SMILES | CCC(CC)(C(=O)NCCC1CCNC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H26Cl2N2O/c1-3-18(4-2,14-5-6-15(19)16(20)11-14)17(23)22-10-8-13-7-9-21-12-13/h5-6,11,13,21H,3-4,7-10,12H2,1-2H3,(H,22,23) |
| InChIKey | RHRSEYBDBVIVKT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |