C12H15Cl2N3O — CID 80563195
1-(3,4-dichlorophenyl)-3-(pyrrolidin-3-ylmethyl)urea (PubChem CID 80563195) has the molecular formula C12H15Cl2N3O and a molecular weight of 288.18 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(pyrrolidin-3-ylmethyl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(pyrrolidin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 80563195 |
| Molecular Formula | C12H15Cl2N3O |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(pyrrolidin-3-ylmethyl)urea |
| SMILES | O=C(NCC1CCNC1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2N3O/c13-10-2-1-9(5-11(10)14)17-12(18)16-7-8-3-4-15-6-8/h1-2,5,8,15H,3-4,6-7H2,(H2,16,17,18) |
| InChIKey | OPPCUXMPZSJGBU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |