C19H20Cl2N2O2 — CID 67243293
2-(3,4-dichlorophenyl)ethyl N-(4-pyrrolidin-3-ylphenyl)carbamate (PubChem CID 67243293) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)ethyl N-(4-pyrrolidin-3-ylphenyl)carbamate.
| Compound Name | 2-(3,4-dichlorophenyl)ethyl N-(4-pyrrolidin-3-ylphenyl)carbamate |
|---|---|
| PubChem CID | 67243293 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 2-(3,4-dichlorophenyl)ethyl N-(4-pyrrolidin-3-ylphenyl)carbamate |
| SMILES | O=C(Nc1ccc(C2CCNC2)cc1)OCCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H20Cl2N2O2/c20-17-6-1-13(11-18(17)21)8-10-25-19(24)23-16-4-2-14(3-5-16)15-7-9-22-12-15/h1-6,11,15,22H,7-10,12H2,(H,23,24) |
| InChIKey | XSQYZRDOGXSPPO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |