C19H21ClN2O2 — CID 67241442
2-(3-chlorophenyl)ethyl N-(4-pyrrolidin-3-ylphenyl)carbamate (PubChem CID 67241442) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is 2-(3-chlorophenyl)ethyl N-(4-pyrrolidin-3-ylphenyl)carbamate.
| Compound Name | 2-(3-chlorophenyl)ethyl N-(4-pyrrolidin-3-ylphenyl)carbamate |
|---|---|
| PubChem CID | 67241442 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-(3-chlorophenyl)ethyl N-(4-pyrrolidin-3-ylphenyl)carbamate |
| SMILES | O=C(Nc1ccc(C2CCNC2)cc1)OCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H21ClN2O2/c20-17-3-1-2-14(12-17)9-11-24-19(23)22-18-6-4-15(5-7-18)16-8-10-21-13-16/h1-7,12,16,21H,8-11,13H2,(H,22,23) |
| InChIKey | LZJNATFYOSUYSA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |