C19H23Cl3N6S — CID 90077020
1-[4-[(5-chloro-1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-3-(3,4-dichlorophenyl)thiourea (PubChem CID 90077020) has the molecular formula C19H23Cl3N6S and a molecular weight of 473.86 g/mol. Its IUPAC name is 1-[4-[(5-chloro-1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-3-(3,4-dichlorophenyl)thiourea.
| Compound Name | 1-[4-[(5-chloro-1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-3-(3,4-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 90077020 |
| Molecular Formula | C19H23Cl3N6S |
| Molecular Weight | 473.86 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 1-[4-[(5-chloro-1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-3-(3,4-dichlorophenyl)thiourea |
| SMILES | CCN1CC(Cl)CC(Nc2cc(C)nc(NC(=S)Nc3ccc(Cl)c(Cl)c3)n2)C1 |
| InChI | InChI=1S/C19H23Cl3N6S/c1-3-28-9-12(20)7-14(10-28)24-17-6-11(2)23-18(26-17)27-19(29)25-13-4-5-15(21)16(22)8-13/h4-6,8,12,14H,3,7,9-10H2,1-2H3,(H3,23,24,25,26,27,29) |
| InChIKey | FJPQIFHUXUNHHT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.86 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|