C20H26Cl2N6 — CID 123155860
1-(3,4-dichlorophenyl)-2-[6-[(1-ethylpiperidin-4-yl)amino]-4-methyl-2-pyridinyl]guanidine (PubChem CID 123155860) has the molecular formula C20H26Cl2N6 and a molecular weight of 421.38 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-[6-[(1-ethylpiperidin-4-yl)amino]-4-methyl-2-pyridinyl]guanidine.
| Compound Name | 1-(3,4-dichlorophenyl)-2-[6-[(1-ethylpiperidin-4-yl)amino]-4-methyl-2-pyridinyl]guanidine |
|---|---|
| PubChem CID | 123155860 |
| Molecular Formula | C20H26Cl2N6 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-[6-[(1-ethylpiperidin-4-yl)amino]-4-methyl-2-pyridinyl]guanidine |
| SMILES | CCN1CCC(Nc2cc(C)cc(N=C(N)Nc3ccc(Cl)c(Cl)c3)n2)CC1 |
| InChI | InChI=1S/C20H26Cl2N6/c1-3-28-8-6-14(7-9-28)24-18-10-13(2)11-19(26-18)27-20(23)25-15-4-5-16(21)17(22)12-15/h4-5,10-12,14H,3,6-9H2,1-2H3,(H4,23,24,25,26,27) |
| InChIKey | FKEBZBPOYPTBGO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 78.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|