C13H23N5O — CID 110277893
2-N-(2-methoxyethyl)-6-methyl-4-N-piperidin-3-ylpyrimidine-2,4-diamine (PubChem CID 110277893) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-N-(2-methoxyethyl)-6-methyl-4-N-piperidin-3-ylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(2-methoxyethyl)-6-methyl-4-N-piperidin-3-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 110277893 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 2-N-(2-methoxyethyl)-6-methyl-4-N-piperidin-3-ylpyrimidine-2,4-diamine |
| SMILES | COCCNc1nc(C)cc(NC2CCCNC2)n1 |
| InChI | InChI=1S/C13H23N5O/c1-10-8-12(17-11-4-3-5-14-9-11)18-13(16-10)15-6-7-19-2/h8,11,14H,3-7,9H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | PRAVOQNDOSLFQI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 71.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|