C12H20N4 — CID 80827135
4-N-cyclobutyl-6-methyl-2-N-propylpyrimidine-2,4-diamine (PubChem CID 80827135) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-N-cyclobutyl-6-methyl-2-N-propylpyrimidine-2,4-diamine.
| Compound Name | 4-N-cyclobutyl-6-methyl-2-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80827135 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 4-N-cyclobutyl-6-methyl-2-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCNc1nc(C)cc(NC2CCC2)n1 |
| InChI | InChI=1S/C12H20N4/c1-3-7-13-12-14-9(2)8-11(16-12)15-10-5-4-6-10/h8,10H,3-7H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | LUPWGBFOYSVWDI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |