C9H15N5 — CID 80919275
N-cyclobutyl-2-hydrazinyl-6-methylpyrimidin-4-amine (PubChem CID 80919275) has the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. Its IUPAC name is N-cyclobutyl-2-hydrazinyl-6-methylpyrimidin-4-amine.
| Compound Name | N-cyclobutyl-2-hydrazinyl-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80919275 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | N-cyclobutyl-2-hydrazinyl-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(NC2CCC2)nc(NN)n1 |
| InChI | InChI=1S/C9H15N5/c1-6-5-8(12-7-3-2-4-7)13-9(11-6)14-10/h5,7H,2-4,10H2,1H3,(H2,11,12,13,14) |
| InChIKey | BQZJANZLAWSOFQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|