C9H14N4 — CID 80769558
4-N-cyclopropyl-2-N,6-dimethylpyrimidine-2,4-diamine (PubChem CID 80769558) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 4-N-cyclopropyl-2-N,6-dimethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-cyclopropyl-2-N,6-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80769558 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 4-N-cyclopropyl-2-N,6-dimethylpyrimidine-2,4-diamine |
| SMILES | CNc1nc(C)cc(NC2CC2)n1 |
| InChI | InChI=1S/C9H14N4/c1-6-5-8(12-7-3-4-7)13-9(10-2)11-6/h5,7H,3-4H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | AOWDLYPWDYGKSL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |