C8H10ClN3 — CID 53346646
2-chloro-N-cyclopropyl-6-methylpyrimidin-4-amine (PubChem CID 53346646) has the molecular formula C8H10ClN3 and a molecular weight of 183.64 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-6-methylpyrimidin-4-amine.
| Compound Name | 2-chloro-N-cyclopropyl-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 53346646 |
| Molecular Formula | C8H10ClN3 |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 2-chloro-N-cyclopropyl-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(NC2CC2)nc(Cl)n1 |
| InChI | InChI=1S/C8H10ClN3/c1-5-4-7(11-6-2-3-6)12-8(9)10-5/h4,6H,2-3H2,1H3,(H,10,11,12) |
| InChIKey | UVTADUQYEZQCAM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |