C18H24N4 — CID 112924879
4-N-cycloheptyl-6-methyl-2-N-phenylpyrimidine-2,4-diamine (PubChem CID 112924879) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is 4-N-cycloheptyl-6-methyl-2-N-phenylpyrimidine-2,4-diamine.
| Compound Name | 4-N-cycloheptyl-6-methyl-2-N-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112924879 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 4-N-cycloheptyl-6-methyl-2-N-phenylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(NC2CCCCCC2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C18H24N4/c1-14-13-17(20-15-9-5-2-3-6-10-15)22-18(19-14)21-16-11-7-4-8-12-16/h4,7-8,11-13,15H,2-3,5-6,9-10H2,1H3,(H2,19,20,21,22) |
| InChIKey | DNBDHGGNJJSEEU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |