C13H9ClF4N4O — CID 135312538
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(4-fluoro-6-methylpyrimidin-2-yl)urea (PubChem CID 135312538) has the molecular formula C13H9ClF4N4O and a molecular weight of 348.69 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(4-fluoro-6-methylpyrimidin-2-yl)urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(4-fluoro-6-methylpyrimidin-2-yl)urea |
|---|---|
| PubChem CID | 135312538 |
| Molecular Formula | C13H9ClF4N4O |
| Molecular Weight | 348.69 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(4-fluoro-6-methylpyrimidin-2-yl)urea |
| SMILES | Cc1cc(F)nc(NC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C13H9ClF4N4O/c1-6-4-10(15)21-11(19-6)22-12(23)20-7-2-3-9(14)8(5-7)13(16,17)18/h2-5H,1H3,(H2,19,20,21,22,23) |
| InChIKey | XBSDFXXJIXLITP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.69 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |