C13H12F3N5O3 — CID 134284785
1-[4-(hydroxyamino)-6-methylpyrimidin-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 134284785) has the molecular formula C13H12F3N5O3 and a molecular weight of 343.27 g/mol. Its IUPAC name is 1-[4-(hydroxyamino)-6-methylpyrimidin-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[4-(hydroxyamino)-6-methylpyrimidin-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 134284785 |
| Molecular Formula | C13H12F3N5O3 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 1-[4-(hydroxyamino)-6-methylpyrimidin-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | Cc1cc(NO)nc(NC(=O)Nc2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C13H12F3N5O3/c1-7-6-10(21-23)19-11(17-7)20-12(22)18-8-2-4-9(5-3-8)24-13(14,15)16/h2-6,23H,1H3,(H3,17,18,19,20,21,22) |
| InChIKey | AETVOUZATLBNBL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 108.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|