C14H16F3N5O2 — CID 157489209
1-(4-amino-6-methylpyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]urea;methane (PubChem CID 157489209) has the molecular formula C14H16F3N5O2 and a molecular weight of 343.31 g/mol. Its IUPAC name is 1-(4-amino-6-methylpyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]urea;methane.
| Compound Name | 1-(4-amino-6-methylpyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]urea;methane |
|---|---|
| PubChem CID | 157489209 |
| Molecular Formula | C14H16F3N5O2 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1-(4-amino-6-methylpyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]urea;methane |
| SMILES | C.Cc1cc(N)nc(NC(=O)Nc2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C13H12F3N5O2.CH4/c1-7-6-10(17)20-11(18-7)21-12(22)19-8-2-4-9(5-3-8)23-13(14,15)16;/h2-6H,1H3,(H4,17,18,19,20,21,22);1H4 |
| InChIKey | BXBMRLDTIMFDNF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |