C20H25F3N6O4 — CID 134284605
3-[[6-propan-2-yl-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]pyrimidin-4-yl]amino]propyl N-methylcarbamate (PubChem CID 134284605) has the molecular formula C20H25F3N6O4 and a molecular weight of 470.45 g/mol. Its IUPAC name is 3-[[6-propan-2-yl-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]pyrimidin-4-yl]amino]propyl N-methylcarbamate.
| Compound Name | 3-[[6-propan-2-yl-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]pyrimidin-4-yl]amino]propyl N-methylcarbamate |
|---|---|
| PubChem CID | 134284605 |
| Molecular Formula | C20H25F3N6O4 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 3-[[6-propan-2-yl-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]pyrimidin-4-yl]amino]propyl N-methylcarbamate |
| SMILES | CNC(=O)OCCCNc1cc(C(C)C)nc(NC(=O)Nc2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C20H25F3N6O4/c1-12(2)15-11-16(25-9-4-10-32-19(31)24-3)28-17(27-15)29-18(30)26-13-5-7-14(8-6-13)33-20(21,22)23/h5-8,11-12H,4,9-10H2,1-3H3,(H,24,31)(H3,25,26,27,28,29,30) |
| InChIKey | YGGPXYQLRXHOJY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|