C20H24N6O — CID 157424648
1-[4-(4-aminobutylamino)-6-methylpyrimidin-2-yl]-3-naphthalen-2-ylurea (PubChem CID 157424648) has the molecular formula C20H24N6O and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-[4-(4-aminobutylamino)-6-methylpyrimidin-2-yl]-3-naphthalen-2-ylurea.
| Compound Name | 1-[4-(4-aminobutylamino)-6-methylpyrimidin-2-yl]-3-naphthalen-2-ylurea |
|---|---|
| PubChem CID | 157424648 |
| Molecular Formula | C20H24N6O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-[4-(4-aminobutylamino)-6-methylpyrimidin-2-yl]-3-naphthalen-2-ylurea |
| SMILES | Cc1cc(NCCCCN)nc(NC(=O)Nc2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C20H24N6O/c1-14-12-18(22-11-5-4-10-21)25-19(23-14)26-20(27)24-17-9-8-15-6-2-3-7-16(15)13-17/h2-3,6-9,12-13H,4-5,10-11,21H2,1H3,(H3,22,23,24,25,26,27) |
| InChIKey | NMMGLKLYTJXFED-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|