C18H21N5O4S — CID 147019102
1-(1-benzofuran-5-yl)-3-[4-methyl-6-(3-methylsulfonylpropylamino)pyrimidin-2-yl]urea (PubChem CID 147019102) has the molecular formula C18H21N5O4S and a molecular weight of 403.46 g/mol. Its IUPAC name is 1-(1-benzofuran-5-yl)-3-[4-methyl-6-(3-methylsulfonylpropylamino)pyrimidin-2-yl]urea.
| Compound Name | 1-(1-benzofuran-5-yl)-3-[4-methyl-6-(3-methylsulfonylpropylamino)pyrimidin-2-yl]urea |
|---|---|
| PubChem CID | 147019102 |
| Molecular Formula | C18H21N5O4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 1-(1-benzofuran-5-yl)-3-[4-methyl-6-(3-methylsulfonylpropylamino)pyrimidin-2-yl]urea |
| SMILES | Cc1cc(NCCCS(C)(=O)=O)nc(NC(=O)Nc2ccc3occc3c2)n1 |
| InChI | InChI=1S/C18H21N5O4S/c1-12-10-16(19-7-3-9-28(2,25)26)22-17(20-12)23-18(24)21-14-4-5-15-13(11-14)6-8-27-15/h4-6,8,10-11H,3,7,9H2,1-2H3,(H3,19,20,21,22,23,24) |
| InChIKey | AVIUQUKFUWDZEK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|