C20H22N6O3 — CID 166708829
methyl N-[2-[[6-methyl-2-(naphthalen-2-ylcarbamoylamino)pyrimidin-4-yl]amino]ethyl]carbamate (PubChem CID 166708829) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is methyl N-[2-[[6-methyl-2-(naphthalen-2-ylcarbamoylamino)pyrimidin-4-yl]amino]ethyl]carbamate.
| Compound Name | methyl N-[2-[[6-methyl-2-(naphthalen-2-ylcarbamoylamino)pyrimidin-4-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 166708829 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | methyl N-[2-[[6-methyl-2-(naphthalen-2-ylcarbamoylamino)pyrimidin-4-yl]amino]ethyl]carbamate |
| SMILES | COC(=O)NCCNc1cc(C)nc(NC(=O)Nc2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C20H22N6O3/c1-13-11-17(21-9-10-22-20(28)29-2)25-18(23-13)26-19(27)24-16-8-7-14-5-3-4-6-15(14)12-16/h3-8,11-12H,9-10H2,1-2H3,(H,22,28)(H3,21,23,24,25,26,27) |
| InChIKey | IMQIVMWXOYVLJE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 117.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|