C19H22N6O3S — CID 157343198
1-isoquinolin-6-yl-3-[4-methyl-6-(3-methylsulfonylpropylamino)pyrimidin-2-yl]urea (PubChem CID 157343198) has the molecular formula C19H22N6O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is 1-isoquinolin-6-yl-3-[4-methyl-6-(3-methylsulfonylpropylamino)pyrimidin-2-yl]urea.
| Compound Name | 1-isoquinolin-6-yl-3-[4-methyl-6-(3-methylsulfonylpropylamino)pyrimidin-2-yl]urea |
|---|---|
| PubChem CID | 157343198 |
| Molecular Formula | C19H22N6O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 1-isoquinolin-6-yl-3-[4-methyl-6-(3-methylsulfonylpropylamino)pyrimidin-2-yl]urea |
| SMILES | Cc1cc(NCCCS(C)(=O)=O)nc(NC(=O)Nc2ccc3cnccc3c2)n1 |
| InChI | InChI=1S/C19H22N6O3S/c1-13-10-17(21-7-3-9-29(2,27)28)24-18(22-13)25-19(26)23-16-5-4-15-12-20-8-6-14(15)11-16/h4-6,8,10-12H,3,7,9H2,1-2H3,(H3,21,22,23,24,25,26) |
| InChIKey | XQQFREXTIRAOPJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 125.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|