C18H21N7O3S — CID 134284821
1-[4-[2-(methanesulfonamido)ethylamino]-6-methylpyrimidin-2-yl]-3-quinolin-2-ylurea (PubChem CID 134284821) has the molecular formula C18H21N7O3S and a molecular weight of 415.48 g/mol. Its IUPAC name is 1-[4-[2-(methanesulfonamido)ethylamino]-6-methylpyrimidin-2-yl]-3-quinolin-2-ylurea.
| Compound Name | 1-[4-[2-(methanesulfonamido)ethylamino]-6-methylpyrimidin-2-yl]-3-quinolin-2-ylurea |
|---|---|
| PubChem CID | 134284821 |
| Molecular Formula | C18H21N7O3S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 1-[4-[2-(methanesulfonamido)ethylamino]-6-methylpyrimidin-2-yl]-3-quinolin-2-ylurea |
| SMILES | Cc1cc(NCCNS(C)(=O)=O)nc(NC(=O)Nc2ccc3ccccc3n2)n1 |
| InChI | InChI=1S/C18H21N7O3S/c1-12-11-16(19-9-10-20-29(2,27)28)23-17(21-12)25-18(26)24-15-8-7-13-5-3-4-6-14(13)22-15/h3-8,11,20H,9-10H2,1-2H3,(H3,19,21,22,23,24,25,26) |
| InChIKey | ROYHJORCJKKUHK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|