C11H18N6O3S — CID 134297550
1-ethenyl-3-[4-[2-(methanesulfonamido)ethylamino]-6-methylpyrimidin-2-yl]urea (PubChem CID 134297550) has the molecular formula C11H18N6O3S and a molecular weight of 314.37 g/mol. Its IUPAC name is 1-ethenyl-3-[4-[2-(methanesulfonamido)ethylamino]-6-methylpyrimidin-2-yl]urea.
| Compound Name | 1-ethenyl-3-[4-[2-(methanesulfonamido)ethylamino]-6-methylpyrimidin-2-yl]urea |
|---|---|
| PubChem CID | 134297550 |
| Molecular Formula | C11H18N6O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 1-ethenyl-3-[4-[2-(methanesulfonamido)ethylamino]-6-methylpyrimidin-2-yl]urea |
| SMILES | C=CNC(=O)Nc1nc(C)cc(NCCNS(C)(=O)=O)n1 |
| InChI | InChI=1S/C11H18N6O3S/c1-4-12-11(18)17-10-15-8(2)7-9(16-10)13-5-6-14-21(3,19)20/h4,7,14H,1,5-6H2,2-3H3,(H3,12,13,15,16,17,18) |
| InChIKey | GFUSAQRVVZNKHP-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 125.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|