C11H16N4 — CID 112907684
6-methyl-2-N,4-N-bis(prop-2-enyl)pyrimidine-2,4-diamine (PubChem CID 112907684) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 6-methyl-2-N,4-N-bis(prop-2-enyl)pyrimidine-2,4-diamine.
| Compound Name | 6-methyl-2-N,4-N-bis(prop-2-enyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112907684 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 6-methyl-2-N,4-N-bis(prop-2-enyl)pyrimidine-2,4-diamine |
| SMILES | C=CCNc1cc(C)nc(NCC=C)n1 |
| InChI | InChI=1S/C11H16N4/c1-4-6-12-10-8-9(3)14-11(15-10)13-7-5-2/h4-5,8H,1-2,6-7H2,3H3,(H2,12,13,14,15) |
| InChIKey | CZXUXNMUCJPNSA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|