C15H15N5 — CID 112908070
3-[[6-methyl-2-(prop-2-enylamino)pyrimidin-4-yl]amino]benzonitrile (PubChem CID 112908070) has the molecular formula C15H15N5 and a molecular weight of 265.32 g/mol. Its IUPAC name is 3-[[6-methyl-2-(prop-2-enylamino)pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 3-[[6-methyl-2-(prop-2-enylamino)pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112908070 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 3-[[6-methyl-2-(prop-2-enylamino)pyrimidin-4-yl]amino]benzonitrile |
| SMILES | C=CCNc1nc(C)cc(Nc2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C15H15N5/c1-3-7-17-15-18-11(2)8-14(20-15)19-13-6-4-5-12(9-13)10-16/h3-6,8-9H,1,7H2,2H3,(H2,17,18,19,20) |
| InChIKey | DODGDIHCIILKGJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|