C18H13ClFN5 — CID 112930211
3-[[2-(3-chloro-4-fluoroanilino)-6-methylpyrimidin-4-yl]amino]benzonitrile (PubChem CID 112930211) has the molecular formula C18H13ClFN5 and a molecular weight of 353.79 g/mol. Its IUPAC name is 3-[[2-(3-chloro-4-fluoroanilino)-6-methylpyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 3-[[2-(3-chloro-4-fluoroanilino)-6-methylpyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112930211 |
| Molecular Formula | C18H13ClFN5 |
| Molecular Weight | 353.79 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 3-[[2-(3-chloro-4-fluoroanilino)-6-methylpyrimidin-4-yl]amino]benzonitrile |
| SMILES | Cc1cc(Nc2cccc(C#N)c2)nc(Nc2ccc(F)c(Cl)c2)n1 |
| InChI | InChI=1S/C18H13ClFN5/c1-11-7-17(23-13-4-2-3-12(8-13)10-21)25-18(22-11)24-14-5-6-16(20)15(19)9-14/h2-9H,1H3,(H2,22,23,24,25) |
| InChIKey | GQCBSVVLANRAJA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.79 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |