C19H19ClFN5 — CID 112930165
4-N-(3-chloro-4-fluorophenyl)-2-N-[4-(dimethylamino)phenyl]-6-methylpyrimidine-2,4-diamine (PubChem CID 112930165) has the molecular formula C19H19ClFN5 and a molecular weight of 371.85 g/mol. Its IUPAC name is 4-N-(3-chloro-4-fluorophenyl)-2-N-[4-(dimethylamino)phenyl]-6-methylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-chloro-4-fluorophenyl)-2-N-[4-(dimethylamino)phenyl]-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112930165 |
| Molecular Formula | C19H19ClFN5 |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 4-N-(3-chloro-4-fluorophenyl)-2-N-[4-(dimethylamino)phenyl]-6-methylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ccc(F)c(Cl)c2)nc(Nc2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C19H19ClFN5/c1-12-10-18(23-14-6-9-17(21)16(20)11-14)25-19(22-12)24-13-4-7-15(8-5-13)26(2)3/h4-11H,1-3H3,(H2,22,23,24,25) |
| InChIKey | GDWSJCJYNNIPAI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|