C16H23BN6O2 — CID 140900566
N-dimethyl-N-[2-[[6-methyl-2-(phenylcarbamoylamino)pyrimidin-4-yl]amino]ethyl]boronamidic acid (PubChem CID 140900566) has the molecular formula C16H23BN6O2 and a molecular weight of 342.21 g/mol. Its IUPAC name is N-dimethyl-N-[2-[[6-methyl-2-(phenylcarbamoylamino)pyrimidin-4-yl]amino]ethyl]boronamidic acid.
| Compound Name | N-dimethyl-N-[2-[[6-methyl-2-(phenylcarbamoylamino)pyrimidin-4-yl]amino]ethyl]boronamidic acid |
|---|---|
| PubChem CID | 140900566 |
| Molecular Formula | C16H23BN6O2 |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | N-dimethyl-N-[2-[[6-methyl-2-(phenylcarbamoylamino)pyrimidin-4-yl]amino]ethyl]boronamidic acid |
| SMILES | CB(O)N(C)CCNc1cc(C)nc(NC(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C16H23BN6O2/c1-12-11-14(18-9-10-23(3)17(2)25)21-15(19-12)22-16(24)20-13-7-5-4-6-8-13/h4-8,11,25H,9-10H2,1-3H3,(H3,18,19,20,21,22,24) |
| InChIKey | WGNQRRIDBTVFPT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|