C17H22N6O3 — CID 135312676
methyl N-[2-[[6-methyl-2-[(3-methylphenyl)carbamoylamino]pyrimidin-4-yl]amino]ethyl]carbamate (PubChem CID 135312676) has the molecular formula C17H22N6O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is methyl N-[2-[[6-methyl-2-[(3-methylphenyl)carbamoylamino]pyrimidin-4-yl]amino]ethyl]carbamate.
| Compound Name | methyl N-[2-[[6-methyl-2-[(3-methylphenyl)carbamoylamino]pyrimidin-4-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 135312676 |
| Molecular Formula | C17H22N6O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | methyl N-[2-[[6-methyl-2-[(3-methylphenyl)carbamoylamino]pyrimidin-4-yl]amino]ethyl]carbamate |
| SMILES | COC(=O)NCCNc1cc(C)nc(NC(=O)Nc2cccc(C)c2)n1 |
| InChI | InChI=1S/C17H22N6O3/c1-11-5-4-6-13(9-11)21-16(24)23-15-20-12(2)10-14(22-15)18-7-8-19-17(25)26-3/h4-6,9-10H,7-8H2,1-3H3,(H,19,25)(H3,18,20,21,22,23,24) |
| InChIKey | YXUNTIMYSDWVDM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 117.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|