C17H18Cl2F4N6O — CID 155451223
1-(3,4-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-5-fluoro-6-(trifluoromethyl)pyrimidin-2-yl]urea (PubChem CID 155451223) has the molecular formula C17H18Cl2F4N6O and a molecular weight of 469.27 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-5-fluoro-6-(trifluoromethyl)pyrimidin-2-yl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-5-fluoro-6-(trifluoromethyl)pyrimidin-2-yl]urea |
|---|---|
| PubChem CID | 155451223 |
| Molecular Formula | C17H18Cl2F4N6O |
| Molecular Weight | 469.27 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-5-fluoro-6-(trifluoromethyl)pyrimidin-2-yl]urea |
| SMILES | CN(C)CCCNc1nc(NC(=O)Nc2ccc(Cl)c(Cl)c2)nc(C(F)(F)F)c1F |
| InChI | InChI=1S/C17H18Cl2F4N6O/c1-29(2)7-3-6-24-14-12(20)13(17(21,22)23)26-15(27-14)28-16(30)25-9-4-5-10(18)11(19)8-9/h4-5,8H,3,6-7H2,1-2H3,(H3,24,25,26,27,28,30) |
| InChIKey | LZVGTFNCCJCMPT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.27 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|