C23H30Cl2F2N4O — CID 23567270
1-[2-(3,4-dichlorophenyl)-4-[3-(dimethylamino)propylamino]-2-methylbutyl]-3-(3,4-difluorophenyl)urea (PubChem CID 23567270) has the molecular formula C23H30Cl2F2N4O and a molecular weight of 487.42 g/mol. Its IUPAC name is 1-[2-(3,4-dichlorophenyl)-4-[3-(dimethylamino)propylamino]-2-methylbutyl]-3-(3,4-difluorophenyl)urea.
| Compound Name | 1-[2-(3,4-dichlorophenyl)-4-[3-(dimethylamino)propylamino]-2-methylbutyl]-3-(3,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 23567270 |
| Molecular Formula | C23H30Cl2F2N4O |
| Molecular Weight | 487.42 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 1-[2-(3,4-dichlorophenyl)-4-[3-(dimethylamino)propylamino]-2-methylbutyl]-3-(3,4-difluorophenyl)urea |
| SMILES | CN(C)CCCNCCC(C)(CNC(=O)Nc1ccc(F)c(F)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H30Cl2F2N4O/c1-23(9-11-28-10-4-12-31(2)3,16-5-7-18(24)19(25)13-16)15-29-22(32)30-17-6-8-20(26)21(27)14-17/h5-8,13-14,28H,4,9-12,15H2,1-3H3,(H2,29,30,32) |
| InChIKey | NBCGXMXNVWBQTD-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|