C22H29Cl3N4O — CID 23567294
1-[2-(4-chlorophenyl)-4-[3-(dimethylamino)propylamino]butyl]-3-(3,5-dichlorophenyl)urea (PubChem CID 23567294) has the molecular formula C22H29Cl3N4O and a molecular weight of 471.86 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-4-[3-(dimethylamino)propylamino]butyl]-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-[2-(4-chlorophenyl)-4-[3-(dimethylamino)propylamino]butyl]-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 23567294 |
| Molecular Formula | C22H29Cl3N4O |
| Molecular Weight | 471.86 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-4-[3-(dimethylamino)propylamino]butyl]-3-(3,5-dichlorophenyl)urea |
| SMILES | CN(C)CCCNCCC(CNC(=O)Nc1cc(Cl)cc(Cl)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H29Cl3N4O/c1-29(2)11-3-9-26-10-8-17(16-4-6-18(23)7-5-16)15-27-22(30)28-21-13-19(24)12-20(25)14-21/h4-7,12-14,17,26H,3,8-11,15H2,1-2H3,(H2,27,28,30) |
| InChIKey | CFHJIIUIIYKHQO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.86 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|