About 1-[2-(4-chlorophenyl)-4-[3-(dimethylamino)propylamino]butyl]-3-(3,5-dichlorophenyl)urea
1-[2-(4-chlorophenyl)-4-[3-(dimethylamino)propylamino]butyl]-3-(3,5-dichlorophenyl)urea (PubChem CID 23567294) has the molecular formula C22H29Cl3N4O
and a molecular weight of 471.86 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-4-[3-(dimethylamino)propylamino]butyl]-3-(3,5-dichlorophenyl)urea.
Molecular Properties
| Compound Name | 1-[2-(4-chlorophenyl)-4-[3-(dimethylamino)propylamino]butyl]-3-(3,5-dichlorophenyl)urea |
| PubChem CID | 23567294 |
| Molecular Formula | C22H29Cl3N4O |
| Molecular Weight | 471.86 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-4-[3-(dimethylamino)propylamino]butyl]-3-(3,5-dichlorophenyl)urea |
| SMILES | CN(C)CCCNCCC(CNC(=O)Nc1cc(Cl)cc(Cl)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H29Cl3N4O/c1-29(2)11-3-9-26-10-8-17(16-4-6-18(23)7-5-16)15-27-22(30)28-21-13-19(24)12-20(25)14-21/h4-7,12-14,17,26H,3,8-11,15H2,1-2H3,(H2,27,28,30) |
| InChIKey | CFHJIIUIIYKHQO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.86 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(4-chlorophenyl)-4-[3-(dimethylamino)propylamino]butyl]-3-(3,5-dichlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-chlorophenyl)-4-[3-(dimethylamino)propylamino]butyl]-3-(3,5-dichlorophenyl)urea?
The IUPAC name of 1-[2-(4-chlorophenyl)-4-[3-(dimethylamino)propylamino]butyl]-3-(3,5-dichlorophenyl)urea (CID 23567294) is 1-[2-(4-chlorophenyl)-4-[3-(dimethylamino)propylamino]butyl]-3-(3,5-dichlorophenyl)urea.
What is the SMILES notation for 1-[2-(4-chlorophenyl)-4-[3-(dimethylamino)propylamino]butyl]-3-(3,5-dichlorophenyl)urea?
The canonical SMILES for 1-[2-(4-chlorophenyl)-4-[3-(dimethylamino)propylamino]butyl]-3-(3,5-dichlorophenyl)urea is CN(C)CCCNCCC(CNC(=O)Nc1cc(Cl)cc(Cl)c1)c1ccc(Cl)cc1.
What is the InChIKey of 1-[2-(4-chlorophenyl)-4-[3-(dimethylamino)propylamino]butyl]-3-(3,5-dichlorophenyl)urea?
The InChIKey is CFHJIIUIIYKHQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29Cl3N4O/c1-29(2)11-3-9-26-10-8-17(16-4-6-18(23)7-5-16)15-27-22(30)28-21-13-19(24)12-20(25)14-21/h4-7,12-14,17,26H,3,8-11,15H2,1-2H3,(H2,27,28,30).
What are the key properties of 1-[2-(4-chlorophenyl)-4-[3-(dimethylamino)propylamino]butyl]-3-(3,5-dichlorophenyl)urea?
1-[2-(4-chlorophenyl)-4-[3-(dimethylamino)propylamino]butyl]-3-(3,5-dichlorophenyl)urea has a molecular weight of 471.86 g/mol, XLogP of 5.48, 11 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-chlorophenyl)-4-[3-(dimethylamino)propylamino]butyl]-3-(3,5-dichlorophenyl)urea is sourced from PubChem (CID 23567294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).