C24H34Cl2N4O — CID 23567488
1-(3,5-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-2-(3,4-dimethylphenyl)butyl]urea (PubChem CID 23567488) has the molecular formula C24H34Cl2N4O and a molecular weight of 465.47 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-2-(3,4-dimethylphenyl)butyl]urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-2-(3,4-dimethylphenyl)butyl]urea |
|---|---|
| PubChem CID | 23567488 |
| Molecular Formula | C24H34Cl2N4O |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-2-(3,4-dimethylphenyl)butyl]urea |
| SMILES | Cc1ccc(C(CCNCCCN(C)C)CNC(=O)Nc2cc(Cl)cc(Cl)c2)cc1C |
| InChI | InChI=1S/C24H34Cl2N4O/c1-17-6-7-19(12-18(17)2)20(8-10-27-9-5-11-30(3)4)16-28-24(31)29-23-14-21(25)13-22(26)15-23/h6-7,12-15,20,27H,5,8-11,16H2,1-4H3,(H2,28,29,31) |
| InChIKey | XDUPLPUVEFLLIA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|