C25H25Cl2F2N3O2 — CID 23567265
1-[2-(3,4-dichlorophenyl)-4-[2-(4-hydroxyphenyl)ethylamino]butyl]-3-(3,4-difluorophenyl)urea (PubChem CID 23567265) has the molecular formula C25H25Cl2F2N3O2 and a molecular weight of 508.40 g/mol. Its IUPAC name is 1-[2-(3,4-dichlorophenyl)-4-[2-(4-hydroxyphenyl)ethylamino]butyl]-3-(3,4-difluorophenyl)urea.
| Compound Name | 1-[2-(3,4-dichlorophenyl)-4-[2-(4-hydroxyphenyl)ethylamino]butyl]-3-(3,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 23567265 |
| Molecular Formula | C25H25Cl2F2N3O2 |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 1-[2-(3,4-dichlorophenyl)-4-[2-(4-hydroxyphenyl)ethylamino]butyl]-3-(3,4-difluorophenyl)urea |
| SMILES | O=C(NCC(CCNCCc1ccc(O)cc1)c1ccc(Cl)c(Cl)c1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C25H25Cl2F2N3O2/c26-21-7-3-17(13-22(21)27)18(10-12-30-11-9-16-1-5-20(33)6-2-16)15-31-25(34)32-19-4-8-23(28)24(29)14-19/h1-8,13-14,18,30,33H,9-12,15H2,(H2,31,32,34) |
| InChIKey | HWDCNYAPMGYMQN-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|