C25H28Cl2F6N4O2 — CID 23567427
1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(3,4-dichlorophenyl)-4-(2-morpholin-4-ylethylamino)butyl]urea (PubChem CID 23567427) has the molecular formula C25H28Cl2F6N4O2 and a molecular weight of 601.42 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(3,4-dichlorophenyl)-4-(2-morpholin-4-ylethylamino)butyl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(3,4-dichlorophenyl)-4-(2-morpholin-4-ylethylamino)butyl]urea |
|---|---|
| PubChem CID | 23567427 |
| Molecular Formula | C25H28Cl2F6N4O2 |
| Molecular Weight | 601.42 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(3,4-dichlorophenyl)-4-(2-morpholin-4-ylethylamino)butyl]urea |
| SMILES | O=C(NCC(CCNCCN1CCOCC1)c1ccc(Cl)c(Cl)c1)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H28Cl2F6N4O2/c26-21-2-1-16(11-22(21)27)17(3-4-34-5-6-37-7-9-39-10-8-37)15-35-23(38)36-20-13-18(24(28,29)30)12-19(14-20)25(31,32)33/h1-2,11-14,17,34H,3-10,15H2,(H2,35,36,38) |
| InChIKey | MXELHFKDEHJECW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.42 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|