C26H26Cl2F3N3O2 — CID 23567385
1-[2-(3,4-dichlorophenyl)-4-[2-(4-hydroxyphenyl)ethylamino]butyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 23567385) has the molecular formula C26H26Cl2F3N3O2 and a molecular weight of 540.41 g/mol. Its IUPAC name is 1-[2-(3,4-dichlorophenyl)-4-[2-(4-hydroxyphenyl)ethylamino]butyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-(3,4-dichlorophenyl)-4-[2-(4-hydroxyphenyl)ethylamino]butyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 23567385 |
| Molecular Formula | C26H26Cl2F3N3O2 |
| Molecular Weight | 540.41 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | 1-[2-(3,4-dichlorophenyl)-4-[2-(4-hydroxyphenyl)ethylamino]butyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCC(CCNCCc1ccc(O)cc1)c1ccc(Cl)c(Cl)c1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H26Cl2F3N3O2/c27-23-9-6-18(14-24(23)28)19(11-13-32-12-10-17-4-7-22(35)8-5-17)16-33-25(36)34-21-3-1-2-20(15-21)26(29,30)31/h1-9,14-15,19,32,35H,10-13,16H2,(H2,33,34,36) |
| InChIKey | WUEBKSJTFXGUBY-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.41 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|