C27H30Cl2N4O — CID 147294438
1-(3,5-dichlorophenyl)-3-[4-(ethylamino)-2-[4-[3-(methyliminomethyl)phenyl]phenyl]butyl]urea (PubChem CID 147294438) has the molecular formula C27H30Cl2N4O and a molecular weight of 497.47 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[4-(ethylamino)-2-[4-[3-(methyliminomethyl)phenyl]phenyl]butyl]urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[4-(ethylamino)-2-[4-[3-(methyliminomethyl)phenyl]phenyl]butyl]urea |
|---|---|
| PubChem CID | 147294438 |
| Molecular Formula | C27H30Cl2N4O |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[4-(ethylamino)-2-[4-[3-(methyliminomethyl)phenyl]phenyl]butyl]urea |
| SMILES | CCNCCC(CNC(=O)Nc1cc(Cl)cc(Cl)c1)c1ccc(-c2cccc(/C=N/C)c2)cc1 |
| InChI | InChI=1S/C27H30Cl2N4O/c1-3-31-12-11-23(18-32-27(34)33-26-15-24(28)14-25(29)16-26)21-9-7-20(8-10-21)22-6-4-5-19(13-22)17-30-2/h4-10,13-17,23,31H,3,11-12,18H2,1-2H3,(H2,32,33,34)/b30-17+ |
| InChIKey | CUVHFICHZXVNPA-OCSSWDANSA-N |
| XLogP | 6.61 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|