C26H32Cl2N4OS — CID 23567498
1-(3,5-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-2-(4-thiophen-3-ylphenyl)butyl]urea (PubChem CID 23567498) has the molecular formula C26H32Cl2N4OS and a molecular weight of 519.54 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-2-(4-thiophen-3-ylphenyl)butyl]urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-2-(4-thiophen-3-ylphenyl)butyl]urea |
|---|---|
| PubChem CID | 23567498 |
| Molecular Formula | C26H32Cl2N4OS |
| Molecular Weight | 519.54 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-2-(4-thiophen-3-ylphenyl)butyl]urea |
| SMILES | CN(C)CCCNCCC(CNC(=O)Nc1cc(Cl)cc(Cl)c1)c1ccc(-c2ccsc2)cc1 |
| InChI | InChI=1S/C26H32Cl2N4OS/c1-32(2)12-3-10-29-11-8-21(19-4-6-20(7-5-19)22-9-13-34-18-22)17-30-26(33)31-25-15-23(27)14-24(28)16-25/h4-7,9,13-16,18,21,29H,3,8,10-12,17H2,1-2H3,(H2,30,31,33) |
| InChIKey | OSNKKXHLSOOOQL-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.54 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|