C19H26ClN3O — CID 124880062
(3S)-3-(4-chlorophenyl)-N-[3-(dimethylamino)propyl]-4-pyrrol-1-ylbutanamide (PubChem CID 124880062) has the molecular formula C19H26ClN3O and a molecular weight of 347.89 g/mol. Its IUPAC name is (3S)-3-(4-chlorophenyl)-N-[3-(dimethylamino)propyl]-4-pyrrol-1-ylbutanamide.
| Compound Name | (3S)-3-(4-chlorophenyl)-N-[3-(dimethylamino)propyl]-4-pyrrol-1-ylbutanamide |
|---|---|
| PubChem CID | 124880062 |
| Molecular Formula | C19H26ClN3O |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | (3S)-3-(4-chlorophenyl)-N-[3-(dimethylamino)propyl]-4-pyrrol-1-ylbutanamide |
| SMILES | CN(C)CCCNC(=O)C[C@H](Cn1cccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H26ClN3O/c1-22(2)11-5-10-21-19(24)14-17(15-23-12-3-4-13-23)16-6-8-18(20)9-7-16/h3-4,6-9,12-13,17H,5,10-11,14-15H2,1-2H3,(H,21,24)/t17-/m1/s1 |
| InChIKey | YVICTTFGMIMPHO-QGZVFWFLSA-N |
| XLogP | 3.38 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|