C20H23ClN4O — CID 124879790
(3S)-3-(4-chlorophenyl)-N-[2-(2-methylimidazol-1-yl)ethyl]-4-pyrrol-1-ylbutanamide (PubChem CID 124879790) has the molecular formula C20H23ClN4O and a molecular weight of 370.88 g/mol. Its IUPAC name is (3S)-3-(4-chlorophenyl)-N-[2-(2-methylimidazol-1-yl)ethyl]-4-pyrrol-1-ylbutanamide.
| Compound Name | (3S)-3-(4-chlorophenyl)-N-[2-(2-methylimidazol-1-yl)ethyl]-4-pyrrol-1-ylbutanamide |
|---|---|
| PubChem CID | 124879790 |
| Molecular Formula | C20H23ClN4O |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (3S)-3-(4-chlorophenyl)-N-[2-(2-methylimidazol-1-yl)ethyl]-4-pyrrol-1-ylbutanamide |
| SMILES | Cc1nccn1CCNC(=O)C[C@H](Cn1cccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H23ClN4O/c1-16-22-8-12-25(16)13-9-23-20(26)14-18(15-24-10-2-3-11-24)17-4-6-19(21)7-5-17/h2-8,10-12,18H,9,13-15H2,1H3,(H,23,26)/t18-/m1/s1 |
| InChIKey | WDNQAHGTPNRHEK-GOSISDBHSA-N |
| XLogP | 3.64 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |