C17H20N4OS — CID 125431340
(3S)-N-[2-(2-methylimidazol-1-yl)ethyl]-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide (PubChem CID 125431340) has the molecular formula C17H20N4OS and a molecular weight of 328.44 g/mol. Its IUPAC name is (3S)-N-[2-(2-methylimidazol-1-yl)ethyl]-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide.
| Compound Name | (3S)-N-[2-(2-methylimidazol-1-yl)ethyl]-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 125431340 |
| Molecular Formula | C17H20N4OS |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (3S)-N-[2-(2-methylimidazol-1-yl)ethyl]-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide |
| SMILES | Cc1nccn1CCNC(=O)C[C@@H](c1ccsc1)n1cccc1 |
| InChI | InChI=1S/C17H20N4OS/c1-14-18-5-9-20(14)10-6-19-17(22)12-16(15-4-11-23-13-15)21-7-2-3-8-21/h2-5,7-9,11,13,16H,6,10,12H2,1H3,(H,19,22)/t16-/m0/s1 |
| InChIKey | YHDZGZREVDPGDK-INIZCTEOSA-N |
| XLogP | 2.85 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |