C18H19ClN4O — CID 124873986
(3R)-3-(4-chlorophenyl)-N-(2-imidazol-1-ylethyl)-3-pyrrol-1-ylpropanamide (PubChem CID 124873986) has the molecular formula C18H19ClN4O and a molecular weight of 342.83 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-N-(2-imidazol-1-ylethyl)-3-pyrrol-1-ylpropanamide.
| Compound Name | (3R)-3-(4-chlorophenyl)-N-(2-imidazol-1-ylethyl)-3-pyrrol-1-ylpropanamide |
|---|---|
| PubChem CID | 124873986 |
| Molecular Formula | C18H19ClN4O |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-N-(2-imidazol-1-ylethyl)-3-pyrrol-1-ylpropanamide |
| SMILES | O=C(C[C@H](c1ccc(Cl)cc1)n1cccc1)NCCn1ccnc1 |
| InChI | InChI=1S/C18H19ClN4O/c19-16-5-3-15(4-6-16)17(23-9-1-2-10-23)13-18(24)21-8-12-22-11-7-20-14-22/h1-7,9-11,14,17H,8,12-13H2,(H,21,24)/t17-/m1/s1 |
| InChIKey | AMBVBYCVSAXZRT-QGZVFWFLSA-N |
| XLogP | 3.13 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |