C19H21ClN4O — CID 110204989
3-(4-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-3-pyrrol-1-ylpropanamide (PubChem CID 110204989) has the molecular formula C19H21ClN4O and a molecular weight of 356.86 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-3-pyrrol-1-ylpropanamide.
| Compound Name | 3-(4-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-3-pyrrol-1-ylpropanamide |
|---|---|
| PubChem CID | 110204989 |
| Molecular Formula | C19H21ClN4O |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-3-pyrrol-1-ylpropanamide |
| SMILES | O=C(CC(c1ccc(Cl)cc1)n1cccc1)NCCCn1ccnc1 |
| InChI | InChI=1S/C19H21ClN4O/c20-17-6-4-16(5-7-17)18(24-11-1-2-12-24)14-19(25)22-8-3-10-23-13-9-21-15-23/h1-2,4-7,9,11-13,15,18H,3,8,10,14H2,(H,22,25) |
| InChIKey | UCLVJIIZCCACFA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|